C25H32N6O2 — CID 111303459
4-[(2,5-dimethoxyphenyl)methyl]-N-[(2-imidazol-1-ylphenyl)methyl]-N'-methylpiperazine-1-carboximidamide (PubChem CID 111303459) has the molecular formula C25H32N6O2 and a molecular weight of 448.57 g/mol. Its IUPAC name is 4-[(2,5-dimethoxyphenyl)methyl]-N-[(2-imidazol-1-ylphenyl)methyl]-N'-methylpiperazine-1-carboximidamide.
| Compound Name | 4-[(2,5-dimethoxyphenyl)methyl]-N-[(2-imidazol-1-ylphenyl)methyl]-N'-methylpiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111303459 |
| Molecular Formula | C25H32N6O2 |
| Molecular Weight | 448.57 g/mol |
| Exact Mass | 448.26 |
| IUPAC Name | 4-[(2,5-dimethoxyphenyl)methyl]-N-[(2-imidazol-1-ylphenyl)methyl]-N'-methylpiperazine-1-carboximidamide |
| SMILES | C/N=C(\NCc1ccccc1-n1ccnc1)N1CCN(Cc2cc(OC)ccc2OC)CC1 |
| InChI | InChI=1S/C25H32N6O2/c1-26-25(28-17-20-6-4-5-7-23(20)31-11-10-27-19-31)30-14-12-29(13-15-30)18-21-16-22(32-2)8-9-24(21)33-3/h4-11,16,19H,12-15,17-18H2,1-3H3,(H,26,28) |
| InChIKey | OEJIAEVJAWVHOJ-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.57 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|