C24H39IN6O2 — CID 109402202
N-[(3,5-diethyl-1-methylpyrazol-4-yl)methyl]-4-[(2,5-dimethoxyphenyl)methyl]-N'-methylpiperazine-1-carboximidamide;hydroiodide (PubChem CID 109402202) has the molecular formula C24H39IN6O2 and a molecular weight of 570.52 g/mol. Its IUPAC name is N-[(3,5-diethyl-1-methylpyrazol-4-yl)methyl]-4-[(2,5-dimethoxyphenyl)methyl]-N'-methylpiperazine-1-carboximidamide;hydroiodide.
| Compound Name | N-[(3,5-diethyl-1-methylpyrazol-4-yl)methyl]-4-[(2,5-dimethoxyphenyl)methyl]-N'-methylpiperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 109402202 |
| Molecular Formula | C24H39IN6O2 |
| Molecular Weight | 570.52 g/mol |
| Exact Mass | 570.22 |
| IUPAC Name | N-[(3,5-diethyl-1-methylpyrazol-4-yl)methyl]-4-[(2,5-dimethoxyphenyl)methyl]-N'-methylpiperazine-1-carboximidamide;hydroiodide |
| SMILES | CCc1nn(C)c(CC)c1CN/C(=N\C)N1CCN(Cc2cc(OC)ccc2OC)CC1.I |
| InChI | InChI=1S/C24H38N6O2.HI/c1-7-21-20(22(8-2)28(4)27-21)16-26-24(25-3)30-13-11-29(12-14-30)17-18-15-19(31-5)9-10-23(18)32-6;/h9-10,15H,7-8,11-14,16-17H2,1-6H3,(H,25,26);1H |
| InChIKey | LFJAVVZWUSESJO-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.52 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|