C23H44N6O2 — CID 111418949
N-[2-[[[4-[2-(3,5-dimethylpiperidin-1-yl)-2-oxoethyl]piperazin-1-yl]-(ethylamino)methylidene]amino]ethyl]-2,2-dimethylpropanamide (PubChem CID 111418949) has the molecular formula C23H44N6O2 and a molecular weight of 436.65 g/mol. Its IUPAC name is N-[2-[[[4-[2-(3,5-dimethylpiperidin-1-yl)-2-oxoethyl]piperazin-1-yl]-(ethylamino)methylidene]amino]ethyl]-2,2-dimethylpropanamide.
| Compound Name | N-[2-[[[4-[2-(3,5-dimethylpiperidin-1-yl)-2-oxoethyl]piperazin-1-yl]-(ethylamino)methylidene]amino]ethyl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 111418949 |
| Molecular Formula | C23H44N6O2 |
| Molecular Weight | 436.65 g/mol |
| Exact Mass | 436.35 |
| IUPAC Name | N-[2-[[[4-[2-(3,5-dimethylpiperidin-1-yl)-2-oxoethyl]piperazin-1-yl]-(ethylamino)methylidene]amino]ethyl]-2,2-dimethylpropanamide |
| SMILES | CCN/C(=N\CCNC(=O)C(C)(C)C)N1CCN(CC(=O)N2CC(C)CC(C)C2)CC1 |
| InChI | InChI=1S/C23H44N6O2/c1-7-24-22(26-9-8-25-21(31)23(4,5)6)28-12-10-27(11-13-28)17-20(30)29-15-18(2)14-19(3)16-29/h18-19H,7-17H2,1-6H3,(H,24,26)(H,25,31) |
| InChIKey | YDXJYMAYDIFUCY-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 80.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.65 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|