C14H27IN4O — CID 110956221
N-cyclopropyl-4-[[ethylamino(pyrrolidin-1-yl)methylidene]amino]butanamide;hydroiodide (PubChem CID 110956221) has the molecular formula C14H27IN4O and a molecular weight of 394.30 g/mol. Its IUPAC name is N-cyclopropyl-4-[[ethylamino(pyrrolidin-1-yl)methylidene]amino]butanamide;hydroiodide.
| Compound Name | N-cyclopropyl-4-[[ethylamino(pyrrolidin-1-yl)methylidene]amino]butanamide;hydroiodide |
|---|---|
| PubChem CID | 110956221 |
| Molecular Formula | C14H27IN4O |
| Molecular Weight | 394.30 g/mol |
| Exact Mass | 394.12 |
| IUPAC Name | N-cyclopropyl-4-[[ethylamino(pyrrolidin-1-yl)methylidene]amino]butanamide;hydroiodide |
| SMILES | CCN/C(=N\CCCC(=O)NC1CC1)N1CCCC1.I |
| InChI | InChI=1S/C14H26N4O.HI/c1-2-15-14(18-10-3-4-11-18)16-9-5-6-13(19)17-12-7-8-12;/h12H,2-11H2,1H3,(H,15,16)(H,17,19);1H |
| InChIKey | TWRUBXLWKIBFPD-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.30 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|