C22H30FN5O2S — CID 111038078
4-(4-fluorophenyl)-N'-[[2-(propan-2-ylsulfamoylmethyl)phenyl]methyl]piperazine-1-carboximidamide (PubChem CID 111038078) has the molecular formula C22H30FN5O2S and a molecular weight of 447.58 g/mol. Its IUPAC name is 4-(4-fluorophenyl)-N'-[[2-(propan-2-ylsulfamoylmethyl)phenyl]methyl]piperazine-1-carboximidamide.
| Compound Name | 4-(4-fluorophenyl)-N'-[[2-(propan-2-ylsulfamoylmethyl)phenyl]methyl]piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111038078 |
| Molecular Formula | C22H30FN5O2S |
| Molecular Weight | 447.58 g/mol |
| Exact Mass | 447.21 |
| IUPAC Name | 4-(4-fluorophenyl)-N'-[[2-(propan-2-ylsulfamoylmethyl)phenyl]methyl]piperazine-1-carboximidamide |
| SMILES | CC(C)NS(=O)(=O)Cc1ccccc1C/N=C(\N)N1CCN(c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C22H30FN5O2S/c1-17(2)26-31(29,30)16-19-6-4-3-5-18(19)15-25-22(24)28-13-11-27(12-14-28)21-9-7-20(23)8-10-21/h3-10,17,26H,11-16H2,1-2H3,(H2,24,25) |
| InChIKey | BBAXEYUXPSRNQE-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 91.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.58 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|