C23H34FIN6S — CID 111808437
N'-[[1-[(2-ethyl-1,3-thiazol-4-yl)methyl]piperidin-4-yl]methyl]-4-(4-fluorophenyl)piperazine-1-carboximidamide;hydroiodide (PubChem CID 111808437) has the molecular formula C23H34FIN6S and a molecular weight of 572.54 g/mol. Its IUPAC name is N'-[[1-[(2-ethyl-1,3-thiazol-4-yl)methyl]piperidin-4-yl]methyl]-4-(4-fluorophenyl)piperazine-1-carboximidamide;hydroiodide.
| Compound Name | N'-[[1-[(2-ethyl-1,3-thiazol-4-yl)methyl]piperidin-4-yl]methyl]-4-(4-fluorophenyl)piperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111808437 |
| Molecular Formula | C23H34FIN6S |
| Molecular Weight | 572.54 g/mol |
| Exact Mass | 572.16 |
| IUPAC Name | N'-[[1-[(2-ethyl-1,3-thiazol-4-yl)methyl]piperidin-4-yl]methyl]-4-(4-fluorophenyl)piperazine-1-carboximidamide;hydroiodide |
| SMILES | CCc1nc(CN2CCC(C/N=C(\N)N3CCN(c4ccc(F)cc4)CC3)CC2)cs1.I |
| InChI | InChI=1S/C23H33FN6S.HI/c1-2-22-27-20(17-31-22)16-28-9-7-18(8-10-28)15-26-23(25)30-13-11-29(12-14-30)21-5-3-19(24)4-6-21;/h3-6,17-18H,2,7-16H2,1H3,(H2,25,26);1H |
| InChIKey | CJRVKLPJRKXZFM-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 60.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.54 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|