C16H29N5O — CID 111808286
2-[[1-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]piperidin-4-yl]methyl]-1-propan-2-ylguanidine (PubChem CID 111808286) has the molecular formula C16H29N5O and a molecular weight of 307.44 g/mol. Its IUPAC name is 2-[[1-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]piperidin-4-yl]methyl]-1-propan-2-ylguanidine.
| Compound Name | 2-[[1-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]piperidin-4-yl]methyl]-1-propan-2-ylguanidine |
|---|---|
| PubChem CID | 111808286 |
| Molecular Formula | C16H29N5O |
| Molecular Weight | 307.44 g/mol |
| Exact Mass | 307.24 |
| IUPAC Name | 2-[[1-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]piperidin-4-yl]methyl]-1-propan-2-ylguanidine |
| SMILES | Cc1nc(CN2CCC(C/N=C(\N)NC(C)C)CC2)oc1C |
| InChI | InChI=1S/C16H29N5O/c1-11(2)19-16(17)18-9-14-5-7-21(8-6-14)10-15-20-12(3)13(4)22-15/h11,14H,5-10H2,1-4H3,(H3,17,18,19) |
| InChIKey | QXLLTKSCZPBTEM-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 79.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.44 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|