C21H36N6O3 — CID 111808312
ethyl 4-[[N'-[[1-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]piperidin-4-yl]methyl]carbamimidoyl]amino]piperidine-1-carboxylate (PubChem CID 111808312) has the molecular formula C21H36N6O3 and a molecular weight of 420.56 g/mol. Its IUPAC name is ethyl 4-[[N'-[[1-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]piperidin-4-yl]methyl]carbamimidoyl]amino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[[N'-[[1-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]piperidin-4-yl]methyl]carbamimidoyl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 111808312 |
| Molecular Formula | C21H36N6O3 |
| Molecular Weight | 420.56 g/mol |
| Exact Mass | 420.28 |
| IUPAC Name | ethyl 4-[[N'-[[1-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]piperidin-4-yl]methyl]carbamimidoyl]amino]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(N/C(N)=N/CC2CCN(Cc3nc(C)c(C)o3)CC2)CC1 |
| InChI | InChI=1S/C21H36N6O3/c1-4-29-21(28)27-11-7-18(8-12-27)25-20(22)23-13-17-5-9-26(10-6-17)14-19-24-15(2)16(3)30-19/h17-18H,4-14H2,1-3H3,(H3,22,23,25) |
| InChIKey | OLMQUUABLAYEJW-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 109.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.56 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|