C16H31N5O2 — CID 111802010
ethyl 4-[[N'-[(1-methylpiperidin-3-yl)methyl]carbamimidoyl]amino]piperidine-1-carboxylate (PubChem CID 111802010) has the molecular formula C16H31N5O2 and a molecular weight of 325.46 g/mol. Its IUPAC name is ethyl 4-[[N'-[(1-methylpiperidin-3-yl)methyl]carbamimidoyl]amino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[[N'-[(1-methylpiperidin-3-yl)methyl]carbamimidoyl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 111802010 |
| Molecular Formula | C16H31N5O2 |
| Molecular Weight | 325.46 g/mol |
| Exact Mass | 325.25 |
| IUPAC Name | ethyl 4-[[N'-[(1-methylpiperidin-3-yl)methyl]carbamimidoyl]amino]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(N/C(N)=N/CC2CCCN(C)C2)CC1 |
| InChI | InChI=1S/C16H31N5O2/c1-3-23-16(22)21-9-6-14(7-10-21)19-15(17)18-11-13-5-4-8-20(2)12-13/h13-14H,3-12H2,1-2H3,(H3,17,18,19) |
| InChIKey | GXIUQPSTSPYZNY-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 83.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.46 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|