C10H17F3N4O2 — CID 111819646
2-[[amino(morpholin-4-yl)methylidene]amino]-N-methyl-N-(2,2,2-trifluoroethyl)acetamide (PubChem CID 111819646) has the molecular formula C10H17F3N4O2 and a molecular weight of 282.27 g/mol. Its IUPAC name is 2-[[amino(morpholin-4-yl)methylidene]amino]-N-methyl-N-(2,2,2-trifluoroethyl)acetamide.
| Compound Name | 2-[[amino(morpholin-4-yl)methylidene]amino]-N-methyl-N-(2,2,2-trifluoroethyl)acetamide |
|---|---|
| PubChem CID | 111819646 |
| Molecular Formula | C10H17F3N4O2 |
| Molecular Weight | 282.27 g/mol |
| Exact Mass | 282.13 |
| IUPAC Name | 2-[[amino(morpholin-4-yl)methylidene]amino]-N-methyl-N-(2,2,2-trifluoroethyl)acetamide |
| SMILES | CN(CC(F)(F)F)C(=O)C/N=C(\N)N1CCOCC1 |
| InChI | InChI=1S/C10H17F3N4O2/c1-16(7-10(11,12)13)8(18)6-15-9(14)17-2-4-19-5-3-17/h2-7H2,1H3,(H2,14,15) |
| InChIKey | SJTBEXXFHNNYAQ-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 71.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.27 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|