C9H17F2IN4O2 — CID 120663315
2-[[amino(morpholin-4-yl)methylidene]amino]-N-(2,2-difluoroethyl)acetamide;hydroiodide (PubChem CID 120663315) has the molecular formula C9H17F2IN4O2 and a molecular weight of 378.16 g/mol. Its IUPAC name is 2-[[amino(morpholin-4-yl)methylidene]amino]-N-(2,2-difluoroethyl)acetamide;hydroiodide.
| Compound Name | 2-[[amino(morpholin-4-yl)methylidene]amino]-N-(2,2-difluoroethyl)acetamide;hydroiodide |
|---|---|
| PubChem CID | 120663315 |
| Molecular Formula | C9H17F2IN4O2 |
| Molecular Weight | 378.16 g/mol |
| Exact Mass | 378.04 |
| IUPAC Name | 2-[[amino(morpholin-4-yl)methylidene]amino]-N-(2,2-difluoroethyl)acetamide;hydroiodide |
| SMILES | I.N/C(=N\CC(=O)NCC(F)F)N1CCOCC1 |
| InChI | InChI=1S/C9H16F2N4O2.HI/c10-7(11)5-13-8(16)6-14-9(12)15-1-3-17-4-2-15;/h7H,1-6H2,(H2,12,14)(H,13,16);1H |
| InChIKey | IYVLTYPNHBUPSD-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 79.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.16 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|