C11H19F3N4O — CID 111819698
2-[[amino-(cyclobutylmethylamino)methylidene]amino]-N-methyl-N-(2,2,2-trifluoroethyl)acetamide (PubChem CID 111819698) has the molecular formula C11H19F3N4O and a molecular weight of 280.29 g/mol. Its IUPAC name is 2-[[amino-(cyclobutylmethylamino)methylidene]amino]-N-methyl-N-(2,2,2-trifluoroethyl)acetamide.
| Compound Name | 2-[[amino-(cyclobutylmethylamino)methylidene]amino]-N-methyl-N-(2,2,2-trifluoroethyl)acetamide |
|---|---|
| PubChem CID | 111819698 |
| Molecular Formula | C11H19F3N4O |
| Molecular Weight | 280.29 g/mol |
| Exact Mass | 280.15 |
| IUPAC Name | 2-[[amino-(cyclobutylmethylamino)methylidene]amino]-N-methyl-N-(2,2,2-trifluoroethyl)acetamide |
| SMILES | CN(CC(F)(F)F)C(=O)C/N=C(\N)NCC1CCC1 |
| InChI | InChI=1S/C11H19F3N4O/c1-18(7-11(12,13)14)9(19)6-17-10(15)16-5-8-3-2-4-8/h8H,2-7H2,1H3,(H3,15,16,17) |
| InChIKey | CREIWEHBLUTBHA-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 70.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.29 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|