C16H24F3IN4O3 — CID 111819701
2-[[amino-(2,5-diethoxyanilino)methylidene]amino]-N-methyl-N-(2,2,2-trifluoroethyl)acetamide;hydroiodide (PubChem CID 111819701) has the molecular formula C16H24F3IN4O3 and a molecular weight of 504.29 g/mol. Its IUPAC name is 2-[[amino-(2,5-diethoxyanilino)methylidene]amino]-N-methyl-N-(2,2,2-trifluoroethyl)acetamide;hydroiodide.
| Compound Name | 2-[[amino-(2,5-diethoxyanilino)methylidene]amino]-N-methyl-N-(2,2,2-trifluoroethyl)acetamide;hydroiodide |
|---|---|
| PubChem CID | 111819701 |
| Molecular Formula | C16H24F3IN4O3 |
| Molecular Weight | 504.29 g/mol |
| Exact Mass | 504.08 |
| IUPAC Name | 2-[[amino-(2,5-diethoxyanilino)methylidene]amino]-N-methyl-N-(2,2,2-trifluoroethyl)acetamide;hydroiodide |
| SMILES | CCOc1ccc(OCC)c(N/C(N)=N/CC(=O)N(C)CC(F)(F)F)c1.I |
| InChI | InChI=1S/C16H23F3N4O3.HI/c1-4-25-11-6-7-13(26-5-2)12(8-11)22-15(20)21-9-14(24)23(3)10-16(17,18)19;/h6-8H,4-5,9-10H2,1-3H3,(H3,20,21,22);1H |
| InChIKey | YONOPNDBRHUMBG-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 89.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.29 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|