C19H28IN5O2 — CID 111055998
1-(2,5-diethoxyphenyl)-2-[[2-(dimethylamino)-3-pyridinyl]methyl]guanidine;hydroiodide (PubChem CID 111055998) has the molecular formula C19H28IN5O2 and a molecular weight of 485.37 g/mol. Its IUPAC name is 1-(2,5-diethoxyphenyl)-2-[[2-(dimethylamino)-3-pyridinyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-(2,5-diethoxyphenyl)-2-[[2-(dimethylamino)-3-pyridinyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111055998 |
| Molecular Formula | C19H28IN5O2 |
| Molecular Weight | 485.37 g/mol |
| Exact Mass | 485.13 |
| IUPAC Name | 1-(2,5-diethoxyphenyl)-2-[[2-(dimethylamino)-3-pyridinyl]methyl]guanidine;hydroiodide |
| SMILES | CCOc1ccc(OCC)c(N/C(N)=N/Cc2cccnc2N(C)C)c1.I |
| InChI | InChI=1S/C19H27N5O2.HI/c1-5-25-15-9-10-17(26-6-2)16(12-15)23-19(20)22-13-14-8-7-11-21-18(14)24(3)4;/h7-12H,5-6,13H2,1-4H3,(H3,20,22,23);1H |
| InChIKey | CTMDXZYICGUTCJ-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 85.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.37 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|