C18H26IN3O2S — CID 111816925
1-(2,5-diethoxyphenyl)-2-(2-thiophen-2-ylpropyl)guanidine;hydroiodide (PubChem CID 111816925) has the molecular formula C18H26IN3O2S and a molecular weight of 475.40 g/mol. Its IUPAC name is 1-(2,5-diethoxyphenyl)-2-(2-thiophen-2-ylpropyl)guanidine;hydroiodide.
| Compound Name | 1-(2,5-diethoxyphenyl)-2-(2-thiophen-2-ylpropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111816925 |
| Molecular Formula | C18H26IN3O2S |
| Molecular Weight | 475.40 g/mol |
| Exact Mass | 475.08 |
| IUPAC Name | 1-(2,5-diethoxyphenyl)-2-(2-thiophen-2-ylpropyl)guanidine;hydroiodide |
| SMILES | CCOc1ccc(OCC)c(N/C(N)=N/CC(C)c2cccs2)c1.I |
| InChI | InChI=1S/C18H25N3O2S.HI/c1-4-22-14-8-9-16(23-5-2)15(11-14)21-18(19)20-12-13(3)17-7-6-10-24-17;/h6-11,13H,4-5,12H2,1-3H3,(H3,19,20,21);1H |
| InChIKey | JDWZUVAPNWKNRN-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 68.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.40 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|