C14H27IN4O2 — CID 119142484
2-[[amino(morpholin-4-yl)methylidene]amino]-N-cyclohexyl-N-methylacetamide;hydroiodide (PubChem CID 119142484) has the molecular formula C14H27IN4O2 and a molecular weight of 410.30 g/mol. Its IUPAC name is 2-[[amino(morpholin-4-yl)methylidene]amino]-N-cyclohexyl-N-methylacetamide;hydroiodide.
| Compound Name | 2-[[amino(morpholin-4-yl)methylidene]amino]-N-cyclohexyl-N-methylacetamide;hydroiodide |
|---|---|
| PubChem CID | 119142484 |
| Molecular Formula | C14H27IN4O2 |
| Molecular Weight | 410.30 g/mol |
| Exact Mass | 410.12 |
| IUPAC Name | 2-[[amino(morpholin-4-yl)methylidene]amino]-N-cyclohexyl-N-methylacetamide;hydroiodide |
| SMILES | CN(C(=O)C/N=C(\N)N1CCOCC1)C1CCCCC1.I |
| InChI | InChI=1S/C14H26N4O2.HI/c1-17(12-5-3-2-4-6-12)13(19)11-16-14(15)18-7-9-20-10-8-18;/h12H,2-11H2,1H3,(H2,15,16);1H |
| InChIKey | BAQXNOQVENRFIW-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 71.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.30 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|