C20H27F2N5O — CID 109451505
4-(2,5-difluorophenyl)-N'-[2-(3,5-dimethyl-1,2-oxazol-4-yl)ethyl]-N-ethylpiperazine-1-carboximidamide (PubChem CID 109451505) has the molecular formula C20H27F2N5O and a molecular weight of 391.47 g/mol. Its IUPAC name is 4-(2,5-difluorophenyl)-N'-[2-(3,5-dimethyl-1,2-oxazol-4-yl)ethyl]-N-ethylpiperazine-1-carboximidamide.
| Compound Name | 4-(2,5-difluorophenyl)-N'-[2-(3,5-dimethyl-1,2-oxazol-4-yl)ethyl]-N-ethylpiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 109451505 |
| Molecular Formula | C20H27F2N5O |
| Molecular Weight | 391.47 g/mol |
| Exact Mass | 391.22 |
| IUPAC Name | 4-(2,5-difluorophenyl)-N'-[2-(3,5-dimethyl-1,2-oxazol-4-yl)ethyl]-N-ethylpiperazine-1-carboximidamide |
| SMILES | CCN/C(=N\CCc1c(C)noc1C)N1CCN(c2cc(F)ccc2F)CC1 |
| InChI | InChI=1S/C20H27F2N5O/c1-4-23-20(24-8-7-17-14(2)25-28-15(17)3)27-11-9-26(10-12-27)19-13-16(21)5-6-18(19)22/h5-6,13H,4,7-12H2,1-3H3,(H,23,24) |
| InChIKey | GTHRBVHELXUGJZ-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 56.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.47 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|