C21H27FIN5O3 — CID 111312315
1-[2-(4-fluorophenyl)-2-morpholin-4-ylethyl]-2-methyl-3-[(2-nitrophenyl)methyl]guanidine;hydroiodide (PubChem CID 111312315) has the molecular formula C21H27FIN5O3 and a molecular weight of 543.38 g/mol. Its IUPAC name is 1-[2-(4-fluorophenyl)-2-morpholin-4-ylethyl]-2-methyl-3-[(2-nitrophenyl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[2-(4-fluorophenyl)-2-morpholin-4-ylethyl]-2-methyl-3-[(2-nitrophenyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111312315 |
| Molecular Formula | C21H27FIN5O3 |
| Molecular Weight | 543.38 g/mol |
| Exact Mass | 543.11 |
| IUPAC Name | 1-[2-(4-fluorophenyl)-2-morpholin-4-ylethyl]-2-methyl-3-[(2-nitrophenyl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCc1ccccc1[N+](=O)[O-])NCC(c1ccc(F)cc1)N1CCOCC1.I |
| InChI | InChI=1S/C21H26FN5O3.HI/c1-23-21(24-14-17-4-2-3-5-19(17)27(28)29)25-15-20(26-10-12-30-13-11-26)16-6-8-18(22)9-7-16;/h2-9,20H,10-15H2,1H3,(H2,23,24,25);1H |
| InChIKey | OQNARMCAEJLMNY-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 92.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.38 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|