C11H13F2N3O4 — CID 133467157
N-[2-[2-(difluoromethoxy)-4-nitroanilino]ethyl]acetamide (PubChem CID 133467157) has the molecular formula C11H13F2N3O4 and a molecular weight of 289.24 g/mol. Its IUPAC name is N-[2-[2-(difluoromethoxy)-4-nitroanilino]ethyl]acetamide.
| Compound Name | N-[2-[2-(difluoromethoxy)-4-nitroanilino]ethyl]acetamide |
|---|---|
| PubChem CID | 133467157 |
| Molecular Formula | C11H13F2N3O4 |
| Molecular Weight | 289.24 g/mol |
| Exact Mass | 289.09 |
| IUPAC Name | N-[2-[2-(difluoromethoxy)-4-nitroanilino]ethyl]acetamide |
| SMILES | CC(=O)NCCNc1ccc([N+](=O)[O-])cc1OC(F)F |
| InChI | InChI=1S/C11H13F2N3O4/c1-7(17)14-4-5-15-9-3-2-8(16(18)19)6-10(9)20-11(12)13/h2-3,6,11,15H,4-5H2,1H3,(H,14,17) |
| InChIKey | UBWWWKSAFHTNFG-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 93.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.24 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|