C16H15ClF2N2O4 — CID 133473075
2-(3-chlorophenyl)-1-[2-(difluoromethoxy)-4-nitroanilino]propan-2-ol (PubChem CID 133473075) has the molecular formula C16H15ClF2N2O4 and a molecular weight of 372.76 g/mol. Its IUPAC name is 2-(3-chlorophenyl)-1-[2-(difluoromethoxy)-4-nitroanilino]propan-2-ol.
| Compound Name | 2-(3-chlorophenyl)-1-[2-(difluoromethoxy)-4-nitroanilino]propan-2-ol |
|---|---|
| PubChem CID | 133473075 |
| Molecular Formula | C16H15ClF2N2O4 |
| Molecular Weight | 372.76 g/mol |
| Exact Mass | 372.07 |
| IUPAC Name | 2-(3-chlorophenyl)-1-[2-(difluoromethoxy)-4-nitroanilino]propan-2-ol |
| SMILES | CC(O)(CNc1ccc([N+](=O)[O-])cc1OC(F)F)c1cccc(Cl)c1 |
| InChI | InChI=1S/C16H15ClF2N2O4/c1-16(22,10-3-2-4-11(17)7-10)9-20-13-6-5-12(21(23)24)8-14(13)25-15(18)19/h2-8,15,20,22H,9H2,1H3 |
| InChIKey | GXPZZASBLNXLIN-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 84.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.76 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|