C17H17ClN2O4 — CID 129398707
N-[(2S)-2-(3-chlorophenyl)-2-hydroxypropyl]-2-(4-nitrophenyl)acetamide (PubChem CID 129398707) has the molecular formula C17H17ClN2O4 and a molecular weight of 348.79 g/mol. Its IUPAC name is N-[(2S)-2-(3-chlorophenyl)-2-hydroxypropyl]-2-(4-nitrophenyl)acetamide.
| Compound Name | N-[(2S)-2-(3-chlorophenyl)-2-hydroxypropyl]-2-(4-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 129398707 |
| Molecular Formula | C17H17ClN2O4 |
| Molecular Weight | 348.79 g/mol |
| Exact Mass | 348.09 |
| IUPAC Name | N-[(2S)-2-(3-chlorophenyl)-2-hydroxypropyl]-2-(4-nitrophenyl)acetamide |
| SMILES | C[C@@](O)(CNC(=O)Cc1ccc([N+](=O)[O-])cc1)c1cccc(Cl)c1 |
| InChI | InChI=1S/C17H17ClN2O4/c1-17(22,13-3-2-4-14(18)10-13)11-19-16(21)9-12-5-7-15(8-6-12)20(23)24/h2-8,10,22H,9,11H2,1H3,(H,19,21)/t17-/m1/s1 |
| InChIKey | YLXUJSUUUCLORA-QGZVFWFLSA-N |
| XLogP | 2.81 |
| TPSA | 92.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.79 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|