C19H20F3N5O3 — CID 133346925
2,2,2-trifluoro-1-[4-[[[6-methyl-2-(3-nitrophenyl)pyrimidin-4-yl]amino]methyl]piperidin-1-yl]ethanone (PubChem CID 133346925) has the molecular formula C19H20F3N5O3 and a molecular weight of 423.40 g/mol. Its IUPAC name is 2,2,2-trifluoro-1-[4-[[[6-methyl-2-(3-nitrophenyl)pyrimidin-4-yl]amino]methyl]piperidin-1-yl]ethanone.
| Compound Name | 2,2,2-trifluoro-1-[4-[[[6-methyl-2-(3-nitrophenyl)pyrimidin-4-yl]amino]methyl]piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 133346925 |
| Molecular Formula | C19H20F3N5O3 |
| Molecular Weight | 423.40 g/mol |
| Exact Mass | 423.15 |
| IUPAC Name | 2,2,2-trifluoro-1-[4-[[[6-methyl-2-(3-nitrophenyl)pyrimidin-4-yl]amino]methyl]piperidin-1-yl]ethanone |
| SMILES | Cc1cc(NCC2CCN(C(=O)C(F)(F)F)CC2)nc(-c2cccc([N+](=O)[O-])c2)n1 |
| InChI | InChI=1S/C19H20F3N5O3/c1-12-9-16(25-17(24-12)14-3-2-4-15(10-14)27(29)30)23-11-13-5-7-26(8-6-13)18(28)19(20,21)22/h2-4,9-10,13H,5-8,11H2,1H3,(H,23,24,25) |
| InChIKey | NAIMFDRYACBKIZ-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 101.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.40 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|