C12H16F3N5O3 — CID 71858340
2,2,2-trifluoro-1-[4-[[(3-methyl-5-nitroimidazol-4-yl)amino]methyl]piperidin-1-yl]ethanone (PubChem CID 71858340) has the molecular formula C12H16F3N5O3 and a molecular weight of 335.29 g/mol. Its IUPAC name is 2,2,2-trifluoro-1-[4-[[(3-methyl-5-nitroimidazol-4-yl)amino]methyl]piperidin-1-yl]ethanone.
| Compound Name | 2,2,2-trifluoro-1-[4-[[(3-methyl-5-nitroimidazol-4-yl)amino]methyl]piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 71858340 |
| Molecular Formula | C12H16F3N5O3 |
| Molecular Weight | 335.29 g/mol |
| Exact Mass | 335.12 |
| IUPAC Name | 2,2,2-trifluoro-1-[4-[[(3-methyl-5-nitroimidazol-4-yl)amino]methyl]piperidin-1-yl]ethanone |
| SMILES | Cn1cnc([N+](=O)[O-])c1NCC1CCN(C(=O)C(F)(F)F)CC1 |
| InChI | InChI=1S/C12H16F3N5O3/c1-18-7-17-10(20(22)23)9(18)16-6-8-2-4-19(5-3-8)11(21)12(13,14)15/h7-8,16H,2-6H2,1H3 |
| InChIKey | UFOZWLUGKUUFFN-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 93.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.29 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|