C16H21N5O3 — CID 95769196
(2S)-3-methoxy-2-methyl-1-N-[6-methyl-2-(3-nitrophenyl)pyrimidin-4-yl]propane-1,2-diamine (PubChem CID 95769196) has the molecular formula C16H21N5O3 and a molecular weight of 331.38 g/mol. Its IUPAC name is (2S)-3-methoxy-2-methyl-1-N-[6-methyl-2-(3-nitrophenyl)pyrimidin-4-yl]propane-1,2-diamine.
| Compound Name | (2S)-3-methoxy-2-methyl-1-N-[6-methyl-2-(3-nitrophenyl)pyrimidin-4-yl]propane-1,2-diamine |
|---|---|
| PubChem CID | 95769196 |
| Molecular Formula | C16H21N5O3 |
| Molecular Weight | 331.38 g/mol |
| Exact Mass | 331.16 |
| IUPAC Name | (2S)-3-methoxy-2-methyl-1-N-[6-methyl-2-(3-nitrophenyl)pyrimidin-4-yl]propane-1,2-diamine |
| SMILES | COC[C@@](C)(N)CNc1cc(C)nc(-c2cccc([N+](=O)[O-])c2)n1 |
| InChI | InChI=1S/C16H21N5O3/c1-11-7-14(18-9-16(2,17)10-24-3)20-15(19-11)12-5-4-6-13(8-12)21(22)23/h4-8H,9-10,17H2,1-3H3,(H,18,19,20)/t16-/m0/s1 |
| InChIKey | ZYWJMGHRMSGDPF-INIZCTEOSA-N |
| XLogP | 2.14 |
| TPSA | 116.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.38 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|