C17H19BrN6 — CID 75041890
1-(4-bromophenyl)-2-[4-(3,6-dihydro-2H-pyridin-1-yl)-6-methylpyrimidin-2-yl]guanidine (PubChem CID 75041890) has the molecular formula C17H19BrN6 and a molecular weight of 387.29 g/mol. Its IUPAC name is 1-(4-bromophenyl)-2-[4-(3,6-dihydro-2H-pyridin-1-yl)-6-methylpyrimidin-2-yl]guanidine.
| Compound Name | 1-(4-bromophenyl)-2-[4-(3,6-dihydro-2H-pyridin-1-yl)-6-methylpyrimidin-2-yl]guanidine |
|---|---|
| PubChem CID | 75041890 |
| Molecular Formula | C17H19BrN6 |
| Molecular Weight | 387.29 g/mol |
| Exact Mass | 386.09 |
| IUPAC Name | 1-(4-bromophenyl)-2-[4-(3,6-dihydro-2H-pyridin-1-yl)-6-methylpyrimidin-2-yl]guanidine |
| SMILES | Cc1cc(N2CC=CCC2)nc(N=C(N)Nc2ccc(Br)cc2)n1 |
| InChI | InChI=1S/C17H19BrN6/c1-12-11-15(24-9-3-2-4-10-24)22-17(20-12)23-16(19)21-14-7-5-13(18)6-8-14/h2-3,5-8,11H,4,9-10H2,1H3,(H3,19,20,21,22,23) |
| InChIKey | TUCZEYWZTTVDGS-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 79.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.29 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|