C13H15Cl3N2O2 — CID 115631959
2-[2-hydroxyethyl(prop-2-enyl)amino]-N-(2,4,6-trichlorophenyl)acetamide (PubChem CID 115631959) has the molecular formula C13H15Cl3N2O2 and a molecular weight of 337.63 g/mol. Its IUPAC name is 2-[2-hydroxyethyl(prop-2-enyl)amino]-N-(2,4,6-trichlorophenyl)acetamide.
| Compound Name | 2-[2-hydroxyethyl(prop-2-enyl)amino]-N-(2,4,6-trichlorophenyl)acetamide |
|---|---|
| PubChem CID | 115631959 |
| Molecular Formula | C13H15Cl3N2O2 |
| Molecular Weight | 337.63 g/mol |
| Exact Mass | 336.02 |
| IUPAC Name | 2-[2-hydroxyethyl(prop-2-enyl)amino]-N-(2,4,6-trichlorophenyl)acetamide |
| SMILES | C=CCN(CCO)CC(=O)Nc1c(Cl)cc(Cl)cc1Cl |
| InChI | InChI=1S/C13H15Cl3N2O2/c1-2-3-18(4-5-19)8-12(20)17-13-10(15)6-9(14)7-11(13)16/h2,6-7,19H,1,3-5,8H2,(H,17,20) |
| InChIKey | YSWJGAQVDOGGAT-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.63 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|