C9H17N3O3 — CID 115747968
N'-acetyl-2-[2-hydroxyethyl(prop-2-enyl)amino]acetohydrazide (PubChem CID 115747968) has the molecular formula C9H17N3O3 and a molecular weight of 215.25 g/mol. Its IUPAC name is N'-acetyl-2-[2-hydroxyethyl(prop-2-enyl)amino]acetohydrazide.
| Compound Name | N'-acetyl-2-[2-hydroxyethyl(prop-2-enyl)amino]acetohydrazide |
|---|---|
| PubChem CID | 115747968 |
| Molecular Formula | C9H17N3O3 |
| Molecular Weight | 215.25 g/mol |
| Exact Mass | 215.13 |
| IUPAC Name | N'-acetyl-2-[2-hydroxyethyl(prop-2-enyl)amino]acetohydrazide |
| SMILES | C=CCN(CCO)CC(=O)NNC(C)=O |
| InChI | InChI=1S/C9H17N3O3/c1-3-4-12(5-6-13)7-9(15)11-10-8(2)14/h3,13H,1,4-7H2,2H3,(H,10,14)(H,11,15) |
| InChIKey | DUGRHNFBLFAGKH-UHFFFAOYSA-N |
| XLogP | -1.37 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.25 |
| LogP ≤ 5 | -1.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|