C7H15N3O3 — CID 60683622
N'-acetyl-2-[2-hydroxyethyl(methyl)amino]acetohydrazide (PubChem CID 60683622) has the molecular formula C7H15N3O3 and a molecular weight of 189.21 g/mol. Its IUPAC name is N'-acetyl-2-[2-hydroxyethyl(methyl)amino]acetohydrazide.
| Compound Name | N'-acetyl-2-[2-hydroxyethyl(methyl)amino]acetohydrazide |
|---|---|
| PubChem CID | 60683622 |
| Molecular Formula | C7H15N3O3 |
| Molecular Weight | 189.21 g/mol |
| Exact Mass | 189.11 |
| IUPAC Name | N'-acetyl-2-[2-hydroxyethyl(methyl)amino]acetohydrazide |
| SMILES | CC(=O)NNC(=O)CN(C)CCO |
| InChI | InChI=1S/C7H15N3O3/c1-6(12)8-9-7(13)5-10(2)3-4-11/h11H,3-5H2,1-2H3,(H,8,12)(H,9,13) |
| InChIKey | HMEDGIHXNUDRPF-UHFFFAOYSA-N |
| XLogP | -1.92 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.21 |
| LogP ≤ 5 | -1.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|