C15H20N2O3 — CID 115631892
N-(2-acetylphenyl)-2-[2-hydroxyethyl(prop-2-enyl)amino]acetamide (PubChem CID 115631892) has the molecular formula C15H20N2O3 and a molecular weight of 276.34 g/mol. Its IUPAC name is N-(2-acetylphenyl)-2-[2-hydroxyethyl(prop-2-enyl)amino]acetamide.
| Compound Name | N-(2-acetylphenyl)-2-[2-hydroxyethyl(prop-2-enyl)amino]acetamide |
|---|---|
| PubChem CID | 115631892 |
| Molecular Formula | C15H20N2O3 |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.15 |
| IUPAC Name | N-(2-acetylphenyl)-2-[2-hydroxyethyl(prop-2-enyl)amino]acetamide |
| SMILES | C=CCN(CCO)CC(=O)Nc1ccccc1C(C)=O |
| InChI | InChI=1S/C15H20N2O3/c1-3-8-17(9-10-18)11-15(20)16-14-7-5-4-6-13(14)12(2)19/h3-7,18H,1,8-11H2,2H3,(H,16,20) |
| InChIKey | OPNCEVKEQBSKNW-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|