C14H19ClN2O4 — CID 61184960
2-[butan-2-yl-[(5-chloro-2-methoxyphenyl)carbamoyl]amino]acetic acid (PubChem CID 61184960) has the molecular formula C14H19ClN2O4 and a molecular weight of 314.77 g/mol. Its IUPAC name is 2-[butan-2-yl-[(5-chloro-2-methoxyphenyl)carbamoyl]amino]acetic acid.
| Compound Name | 2-[butan-2-yl-[(5-chloro-2-methoxyphenyl)carbamoyl]amino]acetic acid |
|---|---|
| PubChem CID | 61184960 |
| Molecular Formula | C14H19ClN2O4 |
| Molecular Weight | 314.77 g/mol |
| Exact Mass | 314.10 |
| IUPAC Name | 2-[butan-2-yl-[(5-chloro-2-methoxyphenyl)carbamoyl]amino]acetic acid |
| SMILES | CCC(C)N(CC(=O)O)C(=O)Nc1cc(Cl)ccc1OC |
| InChI | InChI=1S/C14H19ClN2O4/c1-4-9(2)17(8-13(18)19)14(20)16-11-7-10(15)5-6-12(11)21-3/h5-7,9H,4,8H2,1-3H3,(H,16,20)(H,18,19) |
| InChIKey | OEYQTOPHZBGEQM-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.77 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |