C10H12ClN3O3S — CID 57209393
2-[(5-chloro-2-methoxyphenyl)carbamoyl-sulfanylamino]acetamide (PubChem CID 57209393) has the molecular formula C10H12ClN3O3S and a molecular weight of 289.74 g/mol. Its IUPAC name is 2-[(5-chloro-2-methoxyphenyl)carbamoyl-sulfanylamino]acetamide.
| Compound Name | 2-[(5-chloro-2-methoxyphenyl)carbamoyl-sulfanylamino]acetamide |
|---|---|
| PubChem CID | 57209393 |
| Molecular Formula | C10H12ClN3O3S |
| Molecular Weight | 289.74 g/mol |
| Exact Mass | 289.03 |
| IUPAC Name | 2-[(5-chloro-2-methoxyphenyl)carbamoyl-sulfanylamino]acetamide |
| SMILES | COc1ccc(Cl)cc1NC(=O)N(S)CC(N)=O |
| InChI | InChI=1S/C10H12ClN3O3S/c1-17-8-3-2-6(11)4-7(8)13-10(16)14(18)5-9(12)15/h2-4,18H,5H2,1H3,(H2,12,15)(H,13,16) |
| InChIKey | UGCJVVPJHJDQQZ-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.74 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|