C26H30FNO5 — CID 24678756
(E)-3-(3-fluoro-4-methoxyphenyl)-N-[(3-methoxy-4-prop-2-enoxyphenyl)methyl]-N-(oxolan-2-ylmethyl)prop-2-enamide (PubChem CID 24678756) has the molecular formula C26H30FNO5 and a molecular weight of 455.53 g/mol. Its IUPAC name is (E)-3-(3-fluoro-4-methoxyphenyl)-N-[(3-methoxy-4-prop-2-enoxyphenyl)methyl]-N-(oxolan-2-ylmethyl)prop-2-enamide.
| Compound Name | (E)-3-(3-fluoro-4-methoxyphenyl)-N-[(3-methoxy-4-prop-2-enoxyphenyl)methyl]-N-(oxolan-2-ylmethyl)prop-2-enamide |
|---|---|
| PubChem CID | 24678756 |
| Molecular Formula | C26H30FNO5 |
| Molecular Weight | 455.53 g/mol |
| Exact Mass | 455.21 |
| IUPAC Name | (E)-3-(3-fluoro-4-methoxyphenyl)-N-[(3-methoxy-4-prop-2-enoxyphenyl)methyl]-N-(oxolan-2-ylmethyl)prop-2-enamide |
| SMILES | C=CCOc1ccc(CN(CC2CCCO2)C(=O)/C=C/c2ccc(OC)c(F)c2)cc1OC |
| InChI | InChI=1S/C26H30FNO5/c1-4-13-33-24-11-8-20(16-25(24)31-3)17-28(18-21-6-5-14-32-21)26(29)12-9-19-7-10-23(30-2)22(27)15-19/h4,7-12,15-16,21H,1,5-6,13-14,17-18H2,2-3H3/b12-9+ |
| InChIKey | DCQJAZONQSJKLN-FMIVXFBMSA-N |
| XLogP | 4.63 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.53 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|