C26H28N2O5 — CID 24678770
N-[(3-methoxy-4-prop-2-enoxyphenyl)methyl]-1-oxo-N-(oxolan-2-ylmethyl)-2H-isoquinoline-3-carboxamide (PubChem CID 24678770) has the molecular formula C26H28N2O5 and a molecular weight of 448.52 g/mol. Its IUPAC name is N-[(3-methoxy-4-prop-2-enoxyphenyl)methyl]-1-oxo-N-(oxolan-2-ylmethyl)-2H-isoquinoline-3-carboxamide.
| Compound Name | N-[(3-methoxy-4-prop-2-enoxyphenyl)methyl]-1-oxo-N-(oxolan-2-ylmethyl)-2H-isoquinoline-3-carboxamide |
|---|---|
| PubChem CID | 24678770 |
| Molecular Formula | C26H28N2O5 |
| Molecular Weight | 448.52 g/mol |
| Exact Mass | 448.20 |
| IUPAC Name | N-[(3-methoxy-4-prop-2-enoxyphenyl)methyl]-1-oxo-N-(oxolan-2-ylmethyl)-2H-isoquinoline-3-carboxamide |
| SMILES | C=CCOc1ccc(CN(CC2CCCO2)C(=O)c2cc3ccccc3c(=O)[nH]2)cc1OC |
| InChI | InChI=1S/C26H28N2O5/c1-3-12-33-23-11-10-18(14-24(23)31-2)16-28(17-20-8-6-13-32-20)26(30)22-15-19-7-4-5-9-21(19)25(29)27-22/h3-5,7,9-11,14-15,20H,1,6,8,12-13,16-17H2,2H3,(H,27,29) |
| InChIKey | GCKKNNSZTYUXPP-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 80.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.52 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|