C14H15BrN2O2 — CID 47031796
3-(4-bromophenyl)-1-ethyl-1-(furan-2-ylmethyl)urea (PubChem CID 47031796) has the molecular formula C14H15BrN2O2 and a molecular weight of 323.19 g/mol. Its IUPAC name is 3-(4-bromophenyl)-1-ethyl-1-(furan-2-ylmethyl)urea.
| Compound Name | 3-(4-bromophenyl)-1-ethyl-1-(furan-2-ylmethyl)urea |
|---|---|
| PubChem CID | 47031796 |
| Molecular Formula | C14H15BrN2O2 |
| Molecular Weight | 323.19 g/mol |
| Exact Mass | 322.03 |
| IUPAC Name | 3-(4-bromophenyl)-1-ethyl-1-(furan-2-ylmethyl)urea |
| SMILES | CCN(Cc1ccco1)C(=O)Nc1ccc(Br)cc1 |
| InChI | InChI=1S/C14H15BrN2O2/c1-2-17(10-13-4-3-9-19-13)14(18)16-12-7-5-11(15)6-8-12/h3-9H,2,10H2,1H3,(H,16,18) |
| InChIKey | PJDLNXICVZBPSC-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 45.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.19 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |