C21H26BrN3O3 — CID 42702157
3-(4-bromophenyl)-1-(furan-2-ylmethyl)-1-[3-(4-methylpiperidin-1-yl)-3-oxopropyl]urea (PubChem CID 42702157) has the molecular formula C21H26BrN3O3 and a molecular weight of 448.36 g/mol. Its IUPAC name is 3-(4-bromophenyl)-1-(furan-2-ylmethyl)-1-[3-(4-methylpiperidin-1-yl)-3-oxopropyl]urea.
| Compound Name | 3-(4-bromophenyl)-1-(furan-2-ylmethyl)-1-[3-(4-methylpiperidin-1-yl)-3-oxopropyl]urea |
|---|---|
| PubChem CID | 42702157 |
| Molecular Formula | C21H26BrN3O3 |
| Molecular Weight | 448.36 g/mol |
| Exact Mass | 447.12 |
| IUPAC Name | 3-(4-bromophenyl)-1-(furan-2-ylmethyl)-1-[3-(4-methylpiperidin-1-yl)-3-oxopropyl]urea |
| SMILES | CC1CCN(C(=O)CCN(Cc2ccco2)C(=O)Nc2ccc(Br)cc2)CC1 |
| InChI | InChI=1S/C21H26BrN3O3/c1-16-8-11-24(12-9-16)20(26)10-13-25(15-19-3-2-14-28-19)21(27)23-18-6-4-17(22)5-7-18/h2-7,14,16H,8-13,15H2,1H3,(H,23,27) |
| InChIKey | VEHMSNAVPOCLMN-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 65.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.36 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |