C25H29N3O3 — CID 42702156
1-(furan-2-ylmethyl)-1-[3-(4-methylpiperidin-1-yl)-3-oxopropyl]-3-naphthalen-1-ylurea (PubChem CID 42702156) has the molecular formula C25H29N3O3 and a molecular weight of 419.53 g/mol. Its IUPAC name is 1-(furan-2-ylmethyl)-1-[3-(4-methylpiperidin-1-yl)-3-oxopropyl]-3-naphthalen-1-ylurea.
| Compound Name | 1-(furan-2-ylmethyl)-1-[3-(4-methylpiperidin-1-yl)-3-oxopropyl]-3-naphthalen-1-ylurea |
|---|---|
| PubChem CID | 42702156 |
| Molecular Formula | C25H29N3O3 |
| Molecular Weight | 419.53 g/mol |
| Exact Mass | 419.22 |
| IUPAC Name | 1-(furan-2-ylmethyl)-1-[3-(4-methylpiperidin-1-yl)-3-oxopropyl]-3-naphthalen-1-ylurea |
| SMILES | CC1CCN(C(=O)CCN(Cc2ccco2)C(=O)Nc2cccc3ccccc23)CC1 |
| InChI | InChI=1S/C25H29N3O3/c1-19-11-14-27(15-12-19)24(29)13-16-28(18-21-8-5-17-31-21)25(30)26-23-10-4-7-20-6-2-3-9-22(20)23/h2-10,17,19H,11-16,18H2,1H3,(H,26,30) |
| InChIKey | NMFYRPNCKFMZNK-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 65.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.53 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |