C25H33N3O2 — CID 42699913
3-(3-methylphenyl)-1-[3-(4-methylpiperidin-1-yl)-3-oxopropyl]-1-(2-phenylethyl)urea (PubChem CID 42699913) has the molecular formula C25H33N3O2 and a molecular weight of 407.56 g/mol. Its IUPAC name is 3-(3-methylphenyl)-1-[3-(4-methylpiperidin-1-yl)-3-oxopropyl]-1-(2-phenylethyl)urea.
| Compound Name | 3-(3-methylphenyl)-1-[3-(4-methylpiperidin-1-yl)-3-oxopropyl]-1-(2-phenylethyl)urea |
|---|---|
| PubChem CID | 42699913 |
| Molecular Formula | C25H33N3O2 |
| Molecular Weight | 407.56 g/mol |
| Exact Mass | 407.26 |
| IUPAC Name | 3-(3-methylphenyl)-1-[3-(4-methylpiperidin-1-yl)-3-oxopropyl]-1-(2-phenylethyl)urea |
| SMILES | Cc1cccc(NC(=O)N(CCC(=O)N2CCC(C)CC2)CCc2ccccc2)c1 |
| InChI | InChI=1S/C25H33N3O2/c1-20-11-15-27(16-12-20)24(29)14-18-28(17-13-22-8-4-3-5-9-22)25(30)26-23-10-6-7-21(2)19-23/h3-10,19-20H,11-18H2,1-2H3,(H,26,30) |
| InChIKey | YYKJNLFUWYKNCY-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.56 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |