C26H33N3O4 — CID 42699516
ethyl 1-[3-[benzyl-[(3-methylphenyl)carbamoyl]amino]propanoyl]piperidine-4-carboxylate (PubChem CID 42699516) has the molecular formula C26H33N3O4 and a molecular weight of 451.57 g/mol. Its IUPAC name is ethyl 1-[3-[benzyl-[(3-methylphenyl)carbamoyl]amino]propanoyl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[3-[benzyl-[(3-methylphenyl)carbamoyl]amino]propanoyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 42699516 |
| Molecular Formula | C26H33N3O4 |
| Molecular Weight | 451.57 g/mol |
| Exact Mass | 451.25 |
| IUPAC Name | ethyl 1-[3-[benzyl-[(3-methylphenyl)carbamoyl]amino]propanoyl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(C(=O)CCN(Cc2ccccc2)C(=O)Nc2cccc(C)c2)CC1 |
| InChI | InChI=1S/C26H33N3O4/c1-3-33-25(31)22-12-15-28(16-13-22)24(30)14-17-29(19-21-9-5-4-6-10-21)26(32)27-23-11-7-8-20(2)18-23/h4-11,18,22H,3,12-17,19H2,1-2H3,(H,27,32) |
| InChIKey | SMVNVYHLNAUVNL-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.57 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |