C23H34N2O4 — CID 42699660
ethyl 1-[3-[butanoyl(2-phenylethyl)amino]propanoyl]piperidine-4-carboxylate (PubChem CID 42699660) has the molecular formula C23H34N2O4 and a molecular weight of 402.54 g/mol. Its IUPAC name is ethyl 1-[3-[butanoyl(2-phenylethyl)amino]propanoyl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[3-[butanoyl(2-phenylethyl)amino]propanoyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 42699660 |
| Molecular Formula | C23H34N2O4 |
| Molecular Weight | 402.54 g/mol |
| Exact Mass | 402.25 |
| IUPAC Name | ethyl 1-[3-[butanoyl(2-phenylethyl)amino]propanoyl]piperidine-4-carboxylate |
| SMILES | CCCC(=O)N(CCC(=O)N1CCC(C(=O)OCC)CC1)CCc1ccccc1 |
| InChI | InChI=1S/C23H34N2O4/c1-3-8-21(26)24(15-11-19-9-6-5-7-10-19)18-14-22(27)25-16-12-20(13-17-25)23(28)29-4-2/h5-7,9-10,20H,3-4,8,11-18H2,1-2H3 |
| InChIKey | BSPQWENVVKHMRM-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.54 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |