C24H30N2O2 — CID 86849831
1-butanoyl-N-phenyl-N-(2-phenylethyl)piperidine-4-carboxamide (PubChem CID 86849831) has the molecular formula C24H30N2O2 and a molecular weight of 378.52 g/mol. Its IUPAC name is 1-butanoyl-N-phenyl-N-(2-phenylethyl)piperidine-4-carboxamide.
| Compound Name | 1-butanoyl-N-phenyl-N-(2-phenylethyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 86849831 |
| Molecular Formula | C24H30N2O2 |
| Molecular Weight | 378.52 g/mol |
| Exact Mass | 378.23 |
| IUPAC Name | 1-butanoyl-N-phenyl-N-(2-phenylethyl)piperidine-4-carboxamide |
| SMILES | CCCC(=O)N1CCC(C(=O)N(CCc2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C24H30N2O2/c1-2-9-23(27)25-17-15-21(16-18-25)24(28)26(22-12-7-4-8-13-22)19-14-20-10-5-3-6-11-20/h3-8,10-13,21H,2,9,14-19H2,1H3 |
| InChIKey | UOWJWCCNICDHDM-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.52 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |