C27H37N3O4S — CID 55632993
ethyl 4-methyl-2-[pentyl-[1-(3-phenylpropanoyl)piperidine-4-carbonyl]amino]-1,3-thiazole-5-carboxylate (PubChem CID 55632993) has the molecular formula C27H37N3O4S and a molecular weight of 499.68 g/mol. Its IUPAC name is ethyl 4-methyl-2-[pentyl-[1-(3-phenylpropanoyl)piperidine-4-carbonyl]amino]-1,3-thiazole-5-carboxylate.
| Compound Name | ethyl 4-methyl-2-[pentyl-[1-(3-phenylpropanoyl)piperidine-4-carbonyl]amino]-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 55632993 |
| Molecular Formula | C27H37N3O4S |
| Molecular Weight | 499.68 g/mol |
| Exact Mass | 499.25 |
| IUPAC Name | ethyl 4-methyl-2-[pentyl-[1-(3-phenylpropanoyl)piperidine-4-carbonyl]amino]-1,3-thiazole-5-carboxylate |
| SMILES | CCCCCN(C(=O)C1CCN(C(=O)CCc2ccccc2)CC1)c1nc(C)c(C(=O)OCC)s1 |
| InChI | InChI=1S/C27H37N3O4S/c1-4-6-10-17-30(27-28-20(3)24(35-27)26(33)34-5-2)25(32)22-15-18-29(19-16-22)23(31)14-13-21-11-8-7-9-12-21/h7-9,11-12,22H,4-6,10,13-19H2,1-3H3 |
| InChIKey | VRCOYXSMTRQKGS-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 79.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.68 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|