C17H26N2O5S2 — CID 55478524
ethyl 2-[(1,1-dioxothiolane-3-carbonyl)-pentylamino]-4-methyl-1,3-thiazole-5-carboxylate (PubChem CID 55478524) has the molecular formula C17H26N2O5S2 and a molecular weight of 402.54 g/mol. Its IUPAC name is ethyl 2-[(1,1-dioxothiolane-3-carbonyl)-pentylamino]-4-methyl-1,3-thiazole-5-carboxylate.
| Compound Name | ethyl 2-[(1,1-dioxothiolane-3-carbonyl)-pentylamino]-4-methyl-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 55478524 |
| Molecular Formula | C17H26N2O5S2 |
| Molecular Weight | 402.54 g/mol |
| Exact Mass | 402.13 |
| IUPAC Name | ethyl 2-[(1,1-dioxothiolane-3-carbonyl)-pentylamino]-4-methyl-1,3-thiazole-5-carboxylate |
| SMILES | CCCCCN(C(=O)C1CCS(=O)(=O)C1)c1nc(C)c(C(=O)OCC)s1 |
| InChI | InChI=1S/C17H26N2O5S2/c1-4-6-7-9-19(15(20)13-8-10-26(22,23)11-13)17-18-12(3)14(25-17)16(21)24-5-2/h13H,4-11H2,1-3H3 |
| InChIKey | HMONRNBXOHQIGS-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 93.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.54 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|