C22H28N2O5S — CID 55478756
ethyl 2-[[2-(2,3-dihydro-1,4-benzodioxin-6-yl)acetyl]-pentylamino]-4-methyl-1,3-thiazole-5-carboxylate (PubChem CID 55478756) has the molecular formula C22H28N2O5S and a molecular weight of 432.54 g/mol. Its IUPAC name is ethyl 2-[[2-(2,3-dihydro-1,4-benzodioxin-6-yl)acetyl]-pentylamino]-4-methyl-1,3-thiazole-5-carboxylate.
| Compound Name | ethyl 2-[[2-(2,3-dihydro-1,4-benzodioxin-6-yl)acetyl]-pentylamino]-4-methyl-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 55478756 |
| Molecular Formula | C22H28N2O5S |
| Molecular Weight | 432.54 g/mol |
| Exact Mass | 432.17 |
| IUPAC Name | ethyl 2-[[2-(2,3-dihydro-1,4-benzodioxin-6-yl)acetyl]-pentylamino]-4-methyl-1,3-thiazole-5-carboxylate |
| SMILES | CCCCCN(C(=O)Cc1ccc2c(c1)OCCO2)c1nc(C)c(C(=O)OCC)s1 |
| InChI | InChI=1S/C22H28N2O5S/c1-4-6-7-10-24(22-23-15(3)20(30-22)21(26)27-5-2)19(25)14-16-8-9-17-18(13-16)29-12-11-28-17/h8-9,13H,4-7,10-12,14H2,1-3H3 |
| InChIKey | SSCBFNABSRTDBB-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 77.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.54 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|