C24H32N2O5S — CID 55478680
ethyl 4-methyl-2-[[4-(oxolan-2-ylmethoxy)benzoyl]-pentylamino]-1,3-thiazole-5-carboxylate (PubChem CID 55478680) has the molecular formula C24H32N2O5S and a molecular weight of 460.60 g/mol. Its IUPAC name is ethyl 4-methyl-2-[[4-(oxolan-2-ylmethoxy)benzoyl]-pentylamino]-1,3-thiazole-5-carboxylate.
| Compound Name | ethyl 4-methyl-2-[[4-(oxolan-2-ylmethoxy)benzoyl]-pentylamino]-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 55478680 |
| Molecular Formula | C24H32N2O5S |
| Molecular Weight | 460.60 g/mol |
| Exact Mass | 460.20 |
| IUPAC Name | ethyl 4-methyl-2-[[4-(oxolan-2-ylmethoxy)benzoyl]-pentylamino]-1,3-thiazole-5-carboxylate |
| SMILES | CCCCCN(C(=O)c1ccc(OCC2CCCO2)cc1)c1nc(C)c(C(=O)OCC)s1 |
| InChI | InChI=1S/C24H32N2O5S/c1-4-6-7-14-26(24-25-17(3)21(32-24)23(28)29-5-2)22(27)18-10-12-19(13-11-18)31-16-20-9-8-15-30-20/h10-13,20H,4-9,14-16H2,1-3H3 |
| InChIKey | CNXKEQOZHKRYKN-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 77.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.60 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|