C27H25FN2O6S — CID 4148794
[3-[[(2-ethoxyphenyl)carbamoyl-(furan-2-ylmethyl)amino]methyl]phenyl] 4-fluorobenzenesulfonate (PubChem CID 4148794) has the molecular formula C27H25FN2O6S and a molecular weight of 524.57 g/mol. Its IUPAC name is [3-[[(2-ethoxyphenyl)carbamoyl-(furan-2-ylmethyl)amino]methyl]phenyl] 4-fluorobenzenesulfonate.
| Compound Name | [3-[[(2-ethoxyphenyl)carbamoyl-(furan-2-ylmethyl)amino]methyl]phenyl] 4-fluorobenzenesulfonate |
|---|---|
| PubChem CID | 4148794 |
| Molecular Formula | C27H25FN2O6S |
| Molecular Weight | 524.57 g/mol |
| Exact Mass | 524.14 |
| IUPAC Name | [3-[[(2-ethoxyphenyl)carbamoyl-(furan-2-ylmethyl)amino]methyl]phenyl] 4-fluorobenzenesulfonate |
| SMILES | CCOc1ccccc1NC(=O)N(Cc1cccc(OS(=O)(=O)c2ccc(F)cc2)c1)Cc1ccco1 |
| InChI | InChI=1S/C27H25FN2O6S/c1-2-34-26-11-4-3-10-25(26)29-27(31)30(19-23-9-6-16-35-23)18-20-7-5-8-22(17-20)36-37(32,33)24-14-12-21(28)13-15-24/h3-17H,2,18-19H2,1H3,(H,29,31) |
| InChIKey | COUXQHXMOFKSJF-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 98.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.57 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|