C19H20ClFN2O2S — CID 8767247
3-(3-chloro-4-fluorophenyl)-1-[(2-hydroxyphenyl)methyl]-1-[[(2R)-oxolan-2-yl]methyl]thiourea (PubChem CID 8767247) has the molecular formula C19H20ClFN2O2S and a molecular weight of 394.90 g/mol. Its IUPAC name is 3-(3-chloro-4-fluorophenyl)-1-[(2-hydroxyphenyl)methyl]-1-[[(2R)-oxolan-2-yl]methyl]thiourea.
| Compound Name | 3-(3-chloro-4-fluorophenyl)-1-[(2-hydroxyphenyl)methyl]-1-[[(2R)-oxolan-2-yl]methyl]thiourea |
|---|---|
| PubChem CID | 8767247 |
| Molecular Formula | C19H20ClFN2O2S |
| Molecular Weight | 394.90 g/mol |
| Exact Mass | 394.09 |
| IUPAC Name | 3-(3-chloro-4-fluorophenyl)-1-[(2-hydroxyphenyl)methyl]-1-[[(2R)-oxolan-2-yl]methyl]thiourea |
| SMILES | Oc1ccccc1CN(C[C@H]1CCCO1)C(=S)Nc1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C19H20ClFN2O2S/c20-16-10-14(7-8-17(16)21)22-19(26)23(12-15-5-3-9-25-15)11-13-4-1-2-6-18(13)24/h1-2,4,6-8,10,15,24H,3,5,9,11-12H2,(H,22,26)/t15-/m1/s1 |
| InChIKey | HJUGULDPDKCLBQ-OAHLLOKOSA-N |
| XLogP | 4.56 |
| TPSA | 44.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.90 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|