C30H36N2O5 — CID 5123104
N-tert-butyl-N-[2-[2-(3,4-dimethoxyphenyl)ethyl-(furan-2-ylmethyl)amino]-2-oxoethyl]-3-phenylprop-2-enamide (PubChem CID 5123104) has the molecular formula C30H36N2O5 and a molecular weight of 504.63 g/mol. Its IUPAC name is N-tert-butyl-N-[2-[2-(3,4-dimethoxyphenyl)ethyl-(furan-2-ylmethyl)amino]-2-oxoethyl]-3-phenylprop-2-enamide.
| Compound Name | N-tert-butyl-N-[2-[2-(3,4-dimethoxyphenyl)ethyl-(furan-2-ylmethyl)amino]-2-oxoethyl]-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 5123104 |
| Molecular Formula | C30H36N2O5 |
| Molecular Weight | 504.63 g/mol |
| Exact Mass | 504.26 |
| IUPAC Name | N-tert-butyl-N-[2-[2-(3,4-dimethoxyphenyl)ethyl-(furan-2-ylmethyl)amino]-2-oxoethyl]-3-phenylprop-2-enamide |
| SMILES | COc1ccc(CCN(Cc2ccco2)C(=O)CN(C(=O)C=Cc2ccccc2)C(C)(C)C)cc1OC |
| InChI | InChI=1S/C30H36N2O5/c1-30(2,3)32(28(33)16-14-23-10-7-6-8-11-23)22-29(34)31(21-25-12-9-19-37-25)18-17-24-13-15-26(35-4)27(20-24)36-5/h6-16,19-20H,17-18,21-22H2,1-5H3 |
| InChIKey | TWIOMCDFCDIFDJ-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 72.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.63 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|