C28H32ClN3O7 — CID 4036222
N-tert-butyl-4-chloro-N-[2-[2-(3,4-dimethoxyphenyl)ethyl-(furan-2-ylmethyl)amino]-2-oxoethyl]-3-nitrobenzamide (PubChem CID 4036222) has the molecular formula C28H32ClN3O7 and a molecular weight of 558.03 g/mol. Its IUPAC name is N-tert-butyl-4-chloro-N-[2-[2-(3,4-dimethoxyphenyl)ethyl-(furan-2-ylmethyl)amino]-2-oxoethyl]-3-nitrobenzamide.
| Compound Name | N-tert-butyl-4-chloro-N-[2-[2-(3,4-dimethoxyphenyl)ethyl-(furan-2-ylmethyl)amino]-2-oxoethyl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 4036222 |
| Molecular Formula | C28H32ClN3O7 |
| Molecular Weight | 558.03 g/mol |
| Exact Mass | 557.19 |
| IUPAC Name | N-tert-butyl-4-chloro-N-[2-[2-(3,4-dimethoxyphenyl)ethyl-(furan-2-ylmethyl)amino]-2-oxoethyl]-3-nitrobenzamide |
| SMILES | COc1ccc(CCN(Cc2ccco2)C(=O)CN(C(=O)c2ccc(Cl)c([N+](=O)[O-])c2)C(C)(C)C)cc1OC |
| InChI | InChI=1S/C28H32ClN3O7/c1-28(2,3)31(27(34)20-9-10-22(29)23(16-20)32(35)36)18-26(33)30(17-21-7-6-14-39-21)13-12-19-8-11-24(37-4)25(15-19)38-5/h6-11,14-16H,12-13,17-18H2,1-5H3 |
| InChIKey | XIOLRXTUPJWHQB-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 115.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.03 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|