C26H29ClN2O3 — CID 4291964
N-tert-butyl-2-chloro-N-[2-[furan-2-ylmethyl(2-phenylethyl)amino]-2-oxoethyl]benzamide (PubChem CID 4291964) has the molecular formula C26H29ClN2O3 and a molecular weight of 452.98 g/mol. Its IUPAC name is N-tert-butyl-2-chloro-N-[2-[furan-2-ylmethyl(2-phenylethyl)amino]-2-oxoethyl]benzamide.
| Compound Name | N-tert-butyl-2-chloro-N-[2-[furan-2-ylmethyl(2-phenylethyl)amino]-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 4291964 |
| Molecular Formula | C26H29ClN2O3 |
| Molecular Weight | 452.98 g/mol |
| Exact Mass | 452.19 |
| IUPAC Name | N-tert-butyl-2-chloro-N-[2-[furan-2-ylmethyl(2-phenylethyl)amino]-2-oxoethyl]benzamide |
| SMILES | CC(C)(C)N(CC(=O)N(CCc1ccccc1)Cc1ccco1)C(=O)c1ccccc1Cl |
| InChI | InChI=1S/C26H29ClN2O3/c1-26(2,3)29(25(31)22-13-7-8-14-23(22)27)19-24(30)28(18-21-12-9-17-32-21)16-15-20-10-5-4-6-11-20/h4-14,17H,15-16,18-19H2,1-3H3 |
| InChIKey | KWWVNDQJEBURDQ-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 53.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.98 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |