C29H36N2O3 — CID 3514353
N-tert-butyl-N-[2-[furan-2-ylmethyl(2-phenylethyl)amino]-2-oxoethyl]-2-phenylbutanamide (PubChem CID 3514353) has the molecular formula C29H36N2O3 and a molecular weight of 460.62 g/mol. Its IUPAC name is N-tert-butyl-N-[2-[furan-2-ylmethyl(2-phenylethyl)amino]-2-oxoethyl]-2-phenylbutanamide.
| Compound Name | N-tert-butyl-N-[2-[furan-2-ylmethyl(2-phenylethyl)amino]-2-oxoethyl]-2-phenylbutanamide |
|---|---|
| PubChem CID | 3514353 |
| Molecular Formula | C29H36N2O3 |
| Molecular Weight | 460.62 g/mol |
| Exact Mass | 460.27 |
| IUPAC Name | N-tert-butyl-N-[2-[furan-2-ylmethyl(2-phenylethyl)amino]-2-oxoethyl]-2-phenylbutanamide |
| SMILES | CCC(C(=O)N(CC(=O)N(CCc1ccccc1)Cc1ccco1)C(C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C29H36N2O3/c1-5-26(24-15-10-7-11-16-24)28(33)31(29(2,3)4)22-27(32)30(21-25-17-12-20-34-25)19-18-23-13-8-6-9-14-23/h6-17,20,26H,5,18-19,21-22H2,1-4H3 |
| InChIKey | JTSLACNFNMEKIZ-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 53.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.62 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |